ChemNet > CAS > 19404-18-3 5-chloro-3-methylbenzo[b]thiophene
19404-18-3 5-chloro-3-methylbenzo[b]thiophene
שם המוצר |
5-chloro-3-methylbenzo[b]thiophene |
נרדפות |
5-Chloro-3-methylthianaphthene; 5-chloro-3-methyl-1-benzothiophene |
מולקולרית פורמולה |
C9H7ClS |
משקל מולקולרי |
182.6699 |
InChI |
InChI=1/C9H7ClS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5H,1H3 |
מספר CAS |
19404-18-3 |
מבנה מולקולרי |
|
צפיפות |
1.293g/cm3 |
נקודת ההתוך |
32℃ |
נקודת רתיחה |
280.5°C at 760 mmHg |
משקל סגולי |
1.66 |
נקודת הבזק |
163.1°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|